CAS 2278-95-7 appears in our catalog under these names: Levothyroxine Impurity 27, Levothyroxine Impurity 34. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(E)-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]prop-2-enoic acid (CAS 2278-95-7) is a chemical compound with the molecular formula C15H8I4O4 and a molecular weight of 759.84 g/mol. IUPAC name: (E)-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]prop-2-enoic acid. InChIKey: DHFSBAKYWOQDML-OWOJBTEDSA-N.
| Molecular formula | C15H8I4O4 |
|---|---|
| Molecular weight | 759.84 g/mol |
| IUPAC name | (E)-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]prop-2-enoic acid |
| InChIKey | DHFSBAKYWOQDML-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)O)I)I)/C=C/C(=O)O |
Computed by PubChem (NCBI)