CAS 2278192-30-4 is the registry number for Potassium (2e)-3-(3-methoxyphenyl)prop-2-enoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Potassium (E)-3-(3-methoxyphenyl)prop-2-enoate (CAS 2278192-30-4) is a chemical compound with the molecular formula C10H9KO3 and a molecular weight of 216.27 g/mol. IUPAC name: potassium (E)-3-(3-methoxyphenyl)prop-2-enoate. InChIKey: LCSKVYUTBQBOMP-IPZCTEOASA-M.
| Molecular formula | C10H9KO3 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | potassium (E)-3-(3-methoxyphenyl)prop-2-enoate |
| InChIKey | LCSKVYUTBQBOMP-IPZCTEOASA-M |
| SMILES | COC1=CC=CC(=C1)/C=C/C(=O)[O-].[K+] |
Computed by PubChem (NCBI)