CAS 2278192-35-9 is the registry number for 5'-(4-Cyanophenyl)-2',4',6'-trimethyl-[1,1':3',1''-terphenyl]-4,4''-dicarbonitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[3,5-bis(4-cyanophenyl)-2,4,6-trimethylphenyl]benzonitrile (CAS 2278192-35-9) is a chemical compound with the molecular formula C30H21N3 and a molecular weight of 423.5 g/mol. IUPAC name: 4-[3,5-bis(4-cyanophenyl)-2,4,6-trimethylphenyl]benzonitrile. InChIKey: FHBUAFUCPKRDDH-UHFFFAOYSA-N.
| Molecular formula | C30H21N3 |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | 4-[3,5-bis(4-cyanophenyl)-2,4,6-trimethylphenyl]benzonitrile |
| InChIKey | FHBUAFUCPKRDDH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C2=CC=C(C=C2)C#N)C)C3=CC=C(C=C3)C#N)C)C4=CC=C(C=C4)C#N |
Computed by PubChem (NCBI)