Products 2278294-51-0
CAS 2278294-51-0 is the registry number for tert-Butyl 6'-bromo-2',3'-dihydro-1'H-spiro[cyclopropane-1,4'-[1,8]naphthyridine]-1'-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6-bromospiro[2,3-dihydro-1,8-naphthyridine-4,1'-cyclopropane]-1-carboxylate (CAS 2278294-51-0) is a chemical compound with the molecular formula C15H19BrN2O2 and a molecular weight of 339.23 g/mol. IUPAC name: tert-butyl 6-bromospiro[2,3-dihydro-1,8-naphthyridine-4,1'-cyclopropane]-1-carboxylate. InChIKey: TWTARDJWQMRPEO-UHFFFAOYSA-N.
| Molecular formula | C15H19BrN2O2 |
|---|---|
| Molecular weight | 339.23 g/mol |
| IUPAC name | tert-butyl 6-bromospiro[2,3-dihydro-1,8-naphthyridine-4,1'-cyclopropane]-1-carboxylate |
| InChIKey | TWTARDJWQMRPEO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC2)C3=C1N=CC(=C3)Br |
Computed by PubChem (NCBI)