CAS 2059938-94-0 is the registry number for tert-Butyl-7'-bromo-1',2'-dihydrospiro(azetidine-3,3'-indole)-1-carboxylate. Offered by: TRC. Available pack sizes: 250mg.
Tert-butyl 7-bromospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxylate (CAS 2059938-94-0) is a chemical compound with the molecular formula C15H19BrN2O2 and a molecular weight of 339.23 g/mol. IUPAC name: tert-butyl 7-bromospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxylate. InChIKey: PQSSDSGVQIYYCK-UHFFFAOYSA-N.
| Molecular formula | C15H19BrN2O2 |
|---|---|
| Molecular weight | 339.23 g/mol |
| IUPAC name | tert-butyl 7-bromospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxylate |
| InChIKey | PQSSDSGVQIYYCK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CNC3=C2C=CC=C3Br |
Computed by PubChem (NCBI)