CAS 2279122-00-6 is the registry number for 4-Isobutyl-4,5,6,7-tetrahydro-3h-imidazo[4,5-c]pyridine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
4-(2-methylpropyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine;dihydrochloride (CAS 2279122-00-6) is a chemical compound with the molecular formula C10H19Cl2N3 and a molecular weight of 252.18 g/mol. IUPAC name: 4-(2-methylpropyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine;dihydrochloride. InChIKey: FZWVBJKQIWSTFP-UHFFFAOYSA-N.
| Molecular formula | C10H19Cl2N3 |
|---|---|
| Molecular weight | 252.18 g/mol |
| IUPAC name | 4-(2-methylpropyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine;dihydrochloride |
| InChIKey | FZWVBJKQIWSTFP-UHFFFAOYSA-N |
| SMILES | CC(C)CC1C2=C(CCN1)NC=N2.Cl.Cl |
Computed by PubChem (NCBI)