Products 2279122-46-0

CAS 2279122-46-0 is the registry number for 9-(tert-Butyl-diphenyl-silanyloxy)-2-methyl-nonanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

9-[tert-butyl(diphenyl)silyl]oxy-2-methylnonanoic acid (CAS 2279122-46-0) is a chemical compound with the molecular formula C26H38O3Si and a molecular weight of 426.7 g/mol. IUPAC name: 9-[tert-butyl(diphenyl)silyl]oxy-2-methylnonanoic acid. InChIKey: YCCRZPQCTZNTQX-UHFFFAOYSA-N.

Identity
Molecular formulaC26H38O3Si
Molecular weight426.7 g/mol
IUPAC name9-[tert-butyl(diphenyl)silyl]oxy-2-methylnonanoic acid
InChIKeyYCCRZPQCTZNTQX-UHFFFAOYSA-N
SMILESCC(CCCCCCCO[Si](C1=CC=CC=C1)(C2=CC=CC=C2)C(C)(C)C)C(=O)O

Computed by PubChem (NCBI)