Products 2279122-71-1

CAS 2279122-71-1 is the registry number for 4-Azido-2-trifluoromethyl-benzoic acid 2,5-dioxo-pyrrolidin-1-yl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

(2,5-dioxopyrrolidin-1-yl) 4-azido-2-(trifluoromethyl)benzoate (CAS 2279122-71-1) is a chemical compound with the molecular formula C12H7F3N4O4 and a molecular weight of 328.20 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-azido-2-(trifluoromethyl)benzoate. InChIKey: RIODVIMKNJWQPG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7F3N4O4
Molecular weight328.20 g/mol
IUPAC name(2,5-dioxopyrrolidin-1-yl) 4-azido-2-(trifluoromethyl)benzoate
InChIKeyRIODVIMKNJWQPG-UHFFFAOYSA-N
SMILESC1CC(=O)N(C1=O)OC(=O)C2=C(C=C(C=C2)N=[N+]=[N-])C(F)(F)F

Computed by PubChem (NCBI)