CAS 2279124-19-3 is the registry number for N'-(1-Benzyl-3-bromo-1h-1,2,4-triazol-5-yl)formic hydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-[(2-benzyl-5-bromo-1,2,4-triazol-3-yl)amino]formamide (CAS 2279124-19-3) is a chemical compound with the molecular formula C10H10BrN5O and a molecular weight of 296.12 g/mol. IUPAC name: N-[(2-benzyl-5-bromo-1,2,4-triazol-3-yl)amino]formamide. InChIKey: IACOTFZDFFUPEE-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN5O |
|---|---|
| Molecular weight | 296.12 g/mol |
| IUPAC name | N-[(2-benzyl-5-bromo-1,2,4-triazol-3-yl)amino]formamide |
| InChIKey | IACOTFZDFFUPEE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=NC(=N2)Br)NNC=O |
Computed by PubChem (NCBI)