CAS 2279124-69-3 appears in our catalog under these names: 4,4'-(9-(4'-Carboxy-[1,1'-biphenyl]-4-yl)-9H-carbazole-3,6-diyl)dibenzoic acid, 95%, 4′-[3,6-Bis(4-carboxyphenyl)-9H-carbazol-9-yl][1,1′-biphenyl]-4-carboxylic acid, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg.
4-[4-[3,6-bis(4-carboxyphenyl)carbazol-9-yl]phenyl]benzoic acid (CAS 2279124-69-3) is a chemical compound with the molecular formula C39H25NO6 and a molecular weight of 603.6 g/mol. IUPAC name: 4-[4-[3,6-bis(4-carboxyphenyl)carbazol-9-yl]phenyl]benzoic acid. InChIKey: IDEXSQJSWBYVIV-UHFFFAOYSA-N.
| Molecular formula | C39H25NO6 |
|---|---|
| Molecular weight | 603.6 g/mol |
| IUPAC name | 4-[4-[3,6-bis(4-carboxyphenyl)carbazol-9-yl]phenyl]benzoic acid |
| InChIKey | IDEXSQJSWBYVIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)N3C4=C(C=C(C=C4)C5=CC=C(C=C5)C(=O)O)C6=C3C=CC(=C6)C7=CC=C(C=C7)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)