CAS 227936-62-1 is the registry number for (3-Chlorophenylethynyl)trimethylsilane, 98%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(3-chlorophenyl)ethynyl-trimethylsilane (CAS 227936-62-1) is a chemical compound with the molecular formula C11H13ClSi and a molecular weight of 208.76 g/mol. IUPAC name: 2-(3-chlorophenyl)ethynyl-trimethylsilane. InChIKey: UXVJIDSXBAHIDV-UHFFFAOYSA-N.
| Molecular formula | C11H13ClSi |
|---|---|
| Molecular weight | 208.76 g/mol |
| IUPAC name | 2-(3-chlorophenyl)ethynyl-trimethylsilane |
| InChIKey | UXVJIDSXBAHIDV-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)