CAS 22796-14-1 is the registry number for 1-(1,1-Dimethylethyl)-4-(methylsulfonyl)benzene, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-tert-butyl-4-methylsulfonylbenzene (CAS 22796-14-1) is a chemical compound with the molecular formula C11H16O2S and a molecular weight of 212.31 g/mol. IUPAC name: 1-tert-butyl-4-methylsulfonylbenzene. InChIKey: IJCUWQJHCMMQRC-UHFFFAOYSA-N.
| Molecular formula | C11H16O2S |
|---|---|
| Molecular weight | 212.31 g/mol |
| IUPAC name | 1-tert-butyl-4-methylsulfonylbenzene |
| InChIKey | IJCUWQJHCMMQRC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)C |
Computed by PubChem (NCBI)