Products 2279944-64-6

CAS 2279944-64-6 is the registry number for Cyclophosphamide-c4-tert butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 4-[(2-oxo-1,3,2lambda5-oxazaphosphinan-2-yl)amino]butanoate (CAS 2279944-64-6) is a chemical compound with the molecular formula C11H23N2O4P and a molecular weight of 278.29 g/mol. IUPAC name: tert-butyl 4-[(2-oxo-1,3,2lambda5-oxazaphosphinan-2-yl)amino]butanoate. InChIKey: HIDGADVADHCSJW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H23N2O4P
Molecular weight278.29 g/mol
IUPAC nametert-butyl 4-[(2-oxo-1,3,2lambda5-oxazaphosphinan-2-yl)amino]butanoate
InChIKeyHIDGADVADHCSJW-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)CCCNP1(=O)NCCCO1

Computed by PubChem (NCBI)