CAS 2279944-65-7 is the registry number for Oxyamine-amido-benzoate-tfp ester, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
(2,3,5,6-tetrafluorophenyl) 3-[[(2-aminooxyacetyl)amino]methyl]benzoate (CAS 2279944-65-7) is a chemical compound with the molecular formula C16H12F4N2O4 and a molecular weight of 372.27 g/mol. IUPAC name: (2,3,5,6-tetrafluorophenyl) 3-[[(2-aminooxyacetyl)amino]methyl]benzoate. InChIKey: FFQUJKPEFIUGFK-UHFFFAOYSA-N.
| Molecular formula | C16H12F4N2O4 |
|---|---|
| Molecular weight | 372.27 g/mol |
| IUPAC name | (2,3,5,6-tetrafluorophenyl) 3-[[(2-aminooxyacetyl)amino]methyl]benzoate |
| InChIKey | FFQUJKPEFIUGFK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)OC2=C(C(=CC(=C2F)F)F)F)CNC(=O)CON |
Computed by PubChem (NCBI)