Products 2279944-69-1
CAS 2279944-69-1 appears in our catalog under these names: N,N'-Dme-n-peg2-tert-butyl ester, 95%, N,N'-DME-N-PEG2-Boc, N,N'–DME–N–PEG2–Boc, tert-Butyl 5-methyl-8,11-dioxa-2,5-diazatetradecan-14-oate, 97%, 97%, N,N'-DME-N-PEG2-Boc, 97.0%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 2mg, 5mg, 100mg, 100 mg, 50 mg, 250 mg.
Tert-butyl 3-[2-[2-[methyl-[2-(methylamino)ethyl]amino]ethoxy]ethoxy]propanoate (CAS 2279944-69-1) is a chemical compound with the molecular formula C15H32N2O4 and a molecular weight of 304.43 g/mol. IUPAC name: tert-butyl 3-[2-[2-[methyl-[2-(methylamino)ethyl]amino]ethoxy]ethoxy]propanoate. InChIKey: VROYCYWEWWSVEE-UHFFFAOYSA-N.
| Molecular formula | C15H32N2O4 |
|---|---|
| Molecular weight | 304.43 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[methyl-[2-(methylamino)ethyl]amino]ethoxy]ethoxy]propanoate |
| InChIKey | VROYCYWEWWSVEE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCN(C)CCNC |
Computed by PubChem (NCBI)