CAS 2280-89-9 is the registry number for 5-Amino-2,4,6-triiodo-N-methylisophthalamic Acid. Offered by: TRC. Available pack sizes: 100mg.
3-amino-2,4,6-triiodo-5-(methylcarbamoyl)benzoic acid (CAS 2280-89-9) is a chemical compound with the molecular formula C9H7I3N2O3 and a molecular weight of 571.88 g/mol. IUPAC name: 3-amino-2,4,6-triiodo-5-(methylcarbamoyl)benzoic acid. InChIKey: AKXKBAWZIVNNJR-UHFFFAOYSA-N.
| Molecular formula | C9H7I3N2O3 |
|---|---|
| Molecular weight | 571.88 g/mol |
| IUPAC name | 3-amino-2,4,6-triiodo-5-(methylcarbamoyl)benzoic acid |
| InChIKey | AKXKBAWZIVNNJR-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C(=C(C(=C1I)N)I)C(=O)O)I |
Computed by PubChem (NCBI)