CAS 22801-32-7 appears in our catalog under these names: Penicillamine Impurity 1, Penicillamine Impurity 3, 3,3'-Trithiobis-D-valine, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 25mg, 50mg.
(2S)-2-amino-3-[[(1S)-1-amino-1-carboxy-2-methylpropan-2-yl]trisulfanyl]-3-methylbutanoic acid (CAS 22801-32-7) is a chemical compound with the molecular formula C10H20N2O4S3 and a molecular weight of 328.5 g/mol. IUPAC name: (2S)-2-amino-3-[[(1S)-1-amino-1-carboxy-2-methylpropan-2-yl]trisulfanyl]-3-methylbutanoic acid. InChIKey: YXNSHRAZIFTXCR-WDSKDSINSA-N.
| Molecular formula | C10H20N2O4S3 |
|---|---|
| Molecular weight | 328.5 g/mol |
| IUPAC name | (2S)-2-amino-3-[[(1S)-1-amino-1-carboxy-2-methylpropan-2-yl]trisulfanyl]-3-methylbutanoic acid |
| InChIKey | YXNSHRAZIFTXCR-WDSKDSINSA-N |
| SMILES | CC(C)([C@H](C(=O)O)N)SSSC(C)(C)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)