Products 22808-03-3
CAS 22808-03-3 is the registry number for 3,4-Bis(1,1-dimethylethyl)thiophene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,4-ditert-butylthiophene (CAS 22808-03-3) is a chemical compound with the molecular formula C12H20S and a molecular weight of 196.35 g/mol. IUPAC name: 3,4-ditert-butylthiophene. InChIKey: MVJIADFSQHXQBL-UHFFFAOYSA-N.
| Molecular formula | C12H20S |
|---|---|
| Molecular weight | 196.35 g/mol |
| IUPAC name | 3,4-ditert-butylthiophene |
| InChIKey | MVJIADFSQHXQBL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CSC=C1C(C)(C)C |
Computed by PubChem (NCBI)