CAS 228120-29-4 is the registry number for Dimethyl Trimethylsilyl Propargylphosphonate. Offered by: TRC. Available pack sizes: 500mg, 50mg.
3-dimethoxyphosphorylprop-1-ynyl(trimethyl)silane (CAS 228120-29-4) is a chemical compound with the molecular formula C8H17O3PSi and a molecular weight of 220.28 g/mol. IUPAC name: 3-dimethoxyphosphorylprop-1-ynyl(trimethyl)silane. InChIKey: OOMASFPQMMUBTO-UHFFFAOYSA-N.
| Molecular formula | C8H17O3PSi |
|---|---|
| Molecular weight | 220.28 g/mol |
| IUPAC name | 3-dimethoxyphosphorylprop-1-ynyl(trimethyl)silane |
| InChIKey | OOMASFPQMMUBTO-UHFFFAOYSA-N |
| SMILES | COP(=O)(CC#C[Si](C)(C)C)OC |
Computed by PubChem (NCBI)