CAS 2281769-16-0 is the registry number for N,N-Bis(4-methoxybenzyl)-1-methyl-1H-pyrazole-3-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N,N-bis[(4-methoxyphenyl)methyl]-1-methylpyrazole-3-sulfonamide (CAS 2281769-16-0) is a chemical compound with the molecular formula C20H23N3O4S and a molecular weight of 401.5 g/mol. IUPAC name: N,N-bis[(4-methoxyphenyl)methyl]-1-methylpyrazole-3-sulfonamide. InChIKey: YWEOLCKZEBLLOO-UHFFFAOYSA-N.
| Molecular formula | C20H23N3O4S |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | N,N-bis[(4-methoxyphenyl)methyl]-1-methylpyrazole-3-sulfonamide |
| InChIKey | YWEOLCKZEBLLOO-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=N1)S(=O)(=O)N(CC2=CC=C(C=C2)OC)CC3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)