Products 2281862-95-9
CAS 2281862-95-9 is the registry number for methyl (1S,2S)-2-(tert-butoxycarbonylamino)cyclopropanecarboxylate. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Trans-methyl (1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate (CAS 2281862-95-9) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: trans-methyl (1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate. InChIKey: JYDFYTQQOAHATE-BQBZGAKWSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | trans-methyl (1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate |
| InChIKey | JYDFYTQQOAHATE-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)