CAS 22819-47-2 appears in our catalog under these names: cis-1,1,2,2,3,4-Hexafluorocyclobutane, ≥97%, ≥97%, cis-1,1,2,2,3,4-Hexafluorocyclobutane, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
Cis-(3S,4R)-1,1,2,2,3,4-hexafluorocyclobutane (CAS 22819-47-2) is a chemical compound with the molecular formula C4H2F6 and a molecular weight of 164.05 g/mol. IUPAC name: cis-(3S,4R)-1,1,2,2,3,4-hexafluorocyclobutane. InChIKey: LMSLTAIWOIYSGZ-XIXRPRMCSA-N.
| Molecular formula | C4H2F6 |
|---|---|
| Molecular weight | 164.05 g/mol |
| IUPAC name | cis-(3S,4R)-1,1,2,2,3,4-hexafluorocyclobutane |
| InChIKey | LMSLTAIWOIYSGZ-XIXRPRMCSA-N |
| SMILES | [C@H]1([C@@H](C(C1(F)F)(F)F)F)F |
Computed by PubChem (NCBI)