Products 2283380-26-5
CAS 2283380-26-5 is the registry number for (2-(((tert-Butyldimethylsilyl)oxy)methyl)phenyl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]boronic acid (CAS 2283380-26-5) is a chemical compound with the molecular formula C13H23BO3Si and a molecular weight of 266.22 g/mol. IUPAC name: [2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]boronic acid. InChIKey: MARXKJGVJDGYCZ-UHFFFAOYSA-N.
| Molecular formula | C13H23BO3Si |
|---|---|
| Molecular weight | 266.22 g/mol |
| IUPAC name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]boronic acid |
| InChIKey | MARXKJGVJDGYCZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1CO[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)