Products 2283397-80-6
CAS 2283397-80-6 is the registry number for Perfluorononanoic acid 13C9 50 µg/mL in Methanol:Water. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro(1,2,3,4,5,6,7,8,9-13C9)nonanoic acid (CAS 2283397-80-6) is a chemical compound with the molecular formula C9HF17O2 and a molecular weight of 473.010 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro(1,2,3,4,5,6,7,8,9-13C9)nonanoic acid. InChIKey: UZUFPBIDKMEQEQ-RIQGLZQJSA-N.
| Molecular formula | C9HF17O2 |
|---|---|
| Molecular weight | 473.010 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro(1,2,3,4,5,6,7,8,9-13C9)nonanoic acid |
| InChIKey | UZUFPBIDKMEQEQ-RIQGLZQJSA-N |
| SMILES | [13C](=O)([13C]([13C]([13C]([13C]([13C]([13C]([13C]([13C](F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)
Synonyms:
Perfluoro-n-(13C9)nonanoic acid