CAS 228400-22-4 is the registry number for AFG210. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(4-pyridin-4-yloxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea (CAS 228400-22-4) is a chemical compound with the molecular formula C19H14F3N3O2 and a molecular weight of 373.3 g/mol. IUPAC name: 1-(4-pyridin-4-yloxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea. InChIKey: DDDLGNOZDKDSEG-UHFFFAOYSA-N.
| Molecular formula | C19H14F3N3O2 |
|---|---|
| Molecular weight | 373.3 g/mol |
| IUPAC name | 1-(4-pyridin-4-yloxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea |
| InChIKey | DDDLGNOZDKDSEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)NC2=CC=C(C=C2)OC3=CC=NC=C3)C(F)(F)F |
Computed by PubChem (NCBI)