Products 2284536-18-9
CAS 2284536-18-9 is the registry number for (E)-4-bromo-3,5-dimethylbenzaldehyde oxime, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(NE)-N-[(4-bromo-3,5-dimethylphenyl)methylidene]hydroxylamine (CAS 2284536-18-9) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: (NE)-N-[(4-bromo-3,5-dimethylphenyl)methylidene]hydroxylamine. InChIKey: ZLGZFPSCPHKFLU-VZUCSPMQSA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | (NE)-N-[(4-bromo-3,5-dimethylphenyl)methylidene]hydroxylamine |
| InChIKey | ZLGZFPSCPHKFLU-VZUCSPMQSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)/C=N/O |
Computed by PubChem (NCBI)