CAS 2284738-50-5 is the registry number for 1-(3-(trimethylsilyl)phenyl)cyclobutanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(3-trimethylsilylphenyl)cyclobutan-1-ol (CAS 2284738-50-5) is a chemical compound with the molecular formula C13H20OSi and a molecular weight of 220.38 g/mol. IUPAC name: 1-(3-trimethylsilylphenyl)cyclobutan-1-ol. InChIKey: HLAKQZAUHCPCBE-UHFFFAOYSA-N.
| Molecular formula | C13H20OSi |
|---|---|
| Molecular weight | 220.38 g/mol |
| IUPAC name | 1-(3-trimethylsilylphenyl)cyclobutan-1-ol |
| InChIKey | HLAKQZAUHCPCBE-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC=CC(=C1)C2(CCC2)O |
Computed by PubChem (NCBI)