CAS 2286357-15-9 appears in our catalog under these names: 4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)butanoic acid, 96%, 4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)butanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 0,5g.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanoic acid (CAS 2286357-15-9) is a chemical compound with the molecular formula C10H19BO4 and a molecular weight of 214.07 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanoic acid. InChIKey: NQXMGSHMVIEORJ-UHFFFAOYSA-N.
| Molecular formula | C10H19BO4 |
|---|---|
| Molecular weight | 214.07 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanoic acid |
| InChIKey | NQXMGSHMVIEORJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCCC(=O)O |
Computed by PubChem (NCBI)