CAS 22871-58-5 is the registry number for 3-Amino-5-((2-hydroxyethyl)carbamoyl)-2,4,6-triiodobenzoic Acid. Offered by: Mikromol. Available pack sizes: 25mg.
3-amino-5-(2-hydroxyethylcarbamoyl)-2,4,6-triiodobenzoic acid (CAS 22871-58-5) is a chemical compound with the molecular formula C10H9I3N2O4 and a molecular weight of 601.90 g/mol. IUPAC name: 3-amino-5-(2-hydroxyethylcarbamoyl)-2,4,6-triiodobenzoic acid. InChIKey: WGLWRCXOMJLZME-UHFFFAOYSA-N.
| Molecular formula | C10H9I3N2O4 |
|---|---|
| Molecular weight | 601.90 g/mol |
| IUPAC name | 3-amino-5-(2-hydroxyethylcarbamoyl)-2,4,6-triiodobenzoic acid |
| InChIKey | WGLWRCXOMJLZME-UHFFFAOYSA-N |
| SMILES | C(CO)NC(=O)C1=C(C(=C(C(=C1I)N)I)C(=O)O)I |
Computed by PubChem (NCBI)