Products 2287153-38-0
CAS 2287153-38-0 is the registry number for APJ receptor agonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-(1H-benzimidazol-2-yl)-6-chlorophenyl]-5-[[(1R)-1-phenylbutyl]carbamoyl]benzoic acid (CAS 2287153-38-0) is a chemical compound with the molecular formula C31H26ClN3O3 and a molecular weight of 524.0 g/mol. IUPAC name: 2-[2-(1H-benzimidazol-2-yl)-6-chlorophenyl]-5-[[(1R)-1-phenylbutyl]carbamoyl]benzoic acid. InChIKey: KCWRZNXFHSFVKD-RUZDIDTESA-N.
| Molecular formula | C31H26ClN3O3 |
|---|---|
| Molecular weight | 524.0 g/mol |
| IUPAC name | 2-[2-(1H-benzimidazol-2-yl)-6-chlorophenyl]-5-[[(1R)-1-phenylbutyl]carbamoyl]benzoic acid |
| InChIKey | KCWRZNXFHSFVKD-RUZDIDTESA-N |
| SMILES | CCC[C@H](C1=CC=CC=C1)NC(=O)C2=CC(=C(C=C2)C3=C(C=CC=C3Cl)C4=NC5=CC=CC=C5N4)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
APJ receptor agonist 1, compound 15a