Products 2287236-66-0
CAS 2287236-66-0 is the registry number for ((2S,4S)-4-Chloropyrrolidin-2-yl)methanol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(2S,4S)-4-chloropyrrolidin-2-yl]methanol;hydrochloride (CAS 2287236-66-0) is a chemical compound with the molecular formula C5H11Cl2NO and a molecular weight of 172.05 g/mol. IUPAC name: [(2S,4S)-4-chloropyrrolidin-2-yl]methanol;hydrochloride. InChIKey: LQCABKLLVIZSQX-FHAQVOQBSA-N.
| Molecular formula | C5H11Cl2NO |
|---|---|
| Molecular weight | 172.05 g/mol |
| IUPAC name | [(2S,4S)-4-chloropyrrolidin-2-yl]methanol;hydrochloride |
| InChIKey | LQCABKLLVIZSQX-FHAQVOQBSA-N |
| SMILES | C1[C@@H](CN[C@@H]1CO)Cl.Cl |
Computed by PubChem (NCBI)