CAS 2287247-75-8 is the registry number for (3R,5R)-4,4-Difluoro-3,5-dimethylpiperidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,5R)-4,4-difluoro-3,5-dimethylpiperidine (CAS 2287247-75-8) is a chemical compound with the molecular formula C7H13F2N and a molecular weight of 149.18 g/mol. IUPAC name: (3R,5R)-4,4-difluoro-3,5-dimethylpiperidine. InChIKey: ZYRQFDWQZXHTCE-PHDIDXHHSA-N.
| Molecular formula | C7H13F2N |
|---|---|
| Molecular weight | 149.18 g/mol |
| IUPAC name | (3R,5R)-4,4-difluoro-3,5-dimethylpiperidine |
| InChIKey | ZYRQFDWQZXHTCE-PHDIDXHHSA-N |
| SMILES | C[C@@H]1CNC[C@H](C1(F)F)C |
Computed by PubChem (NCBI)