CAS 2287259-07-6 appears in our catalog under these names: EP4 receptor antagonist 1/ 99.53% (existing batch purity), EP4 Receptor Antagonist 1, Ep4 receptor antagonist 1, EP4 receptor antagonist 1, 99.94%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 10mM/1mL, 1 mg, 100 mg.
4-[(1S)-1-[[5-[(E)-prop-1-enyl]-3-[[4-(trifluoromethyl)phenyl]methyl]triazole-4-carbonyl]amino]ethyl]benzoic acid (CAS 2287259-07-6) is a chemical compound with the molecular formula C23H21F3N4O3 and a molecular weight of 458.4 g/mol. IUPAC name: 4-[(1S)-1-[[5-[(E)-prop-1-enyl]-3-[[4-(trifluoromethyl)phenyl]methyl]triazole-4-carbonyl]amino]ethyl]benzoic acid. InChIKey: ZTWUZRMXAVDXJV-XGACYXMMSA-N.
| Molecular formula | C23H21F3N4O3 |
|---|---|
| Molecular weight | 458.4 g/mol |
| IUPAC name | 4-[(1S)-1-[[5-[(E)-prop-1-enyl]-3-[[4-(trifluoromethyl)phenyl]methyl]triazole-4-carbonyl]amino]ethyl]benzoic acid |
| InChIKey | ZTWUZRMXAVDXJV-XGACYXMMSA-N |
| SMILES | C/C=C/C1=C(N(N=N1)CC2=CC=C(C=C2)C(F)(F)F)C(=O)N[C@@H](C)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)