CAS 2287280-49-1 is the registry number for 1-(1,1-Dioxidotetrahydro-2H-thiopyran-4-yl)-1H-benzo[d][1,2,3]triazole-6-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,1-dioxothian-4-yl)benzotriazole-5-carbonitrile (CAS 2287280-49-1) is a chemical compound with the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. IUPAC name: 3-(1,1-dioxothian-4-yl)benzotriazole-5-carbonitrile. InChIKey: ILQIBNYUWLLALJ-UHFFFAOYSA-N.
| Molecular formula | C12H12N4O2S |
|---|---|
| Molecular weight | 276.32 g/mol |
| IUPAC name | 3-(1,1-dioxothian-4-yl)benzotriazole-5-carbonitrile |
| InChIKey | ILQIBNYUWLLALJ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1N2C3=C(C=CC(=C3)C#N)N=N2 |
Computed by PubChem (NCBI)