Products 2287281-66-5
CAS 2287281-66-5 is the registry number for 1-(1,3-Thiazol-2-yl)bicyclo(2.1.1)hexane-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(1,3-thiazol-2-yl)bicyclo[2.1.1]hexane-5-carboxylic acid (CAS 2287281-66-5) is a chemical compound with the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. IUPAC name: 1-(1,3-thiazol-2-yl)bicyclo[2.1.1]hexane-5-carboxylic acid. InChIKey: KDBRBFSRYHYODS-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2S |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | 1-(1,3-thiazol-2-yl)bicyclo[2.1.1]hexane-5-carboxylic acid |
| InChIKey | KDBRBFSRYHYODS-UHFFFAOYSA-N |
| SMILES | C1CC2(CC1C2C(=O)O)C3=NC=CS3 |
Computed by PubChem (NCBI)