CAS 2287282-43-1 is the registry number for 1-Benzyl-1H-pyrazole-4-carboximidamide hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-benzylpyrazole-4-carboximidamide;hydrochloride (CAS 2287282-43-1) is a chemical compound with the molecular formula C11H13ClN4 and a molecular weight of 236.70 g/mol. IUPAC name: 1-benzylpyrazole-4-carboximidamide;hydrochloride. InChIKey: YKJFTIVWHXYAHH-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN4 |
|---|---|
| Molecular weight | 236.70 g/mol |
| IUPAC name | 1-benzylpyrazole-4-carboximidamide;hydrochloride |
| InChIKey | YKJFTIVWHXYAHH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C=N2)C(=N)N.Cl |
Computed by PubChem (NCBI)