Products 2287282-48-6
CAS 2287282-48-6 is the registry number for 3-(1,1-Dioxo-1λâ¶,2,6-thiadiazinan-2-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(1,1-dioxo-1,2,6-thiadiazinan-2-yl)benzoic acid (CAS 2287282-48-6) is a chemical compound with the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. IUPAC name: 3-(1,1-dioxo-1,2,6-thiadiazinan-2-yl)benzoic acid. InChIKey: BHCHVMDIPYENNV-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4S |
|---|---|
| Molecular weight | 256.28 g/mol |
| IUPAC name | 3-(1,1-dioxo-1,2,6-thiadiazinan-2-yl)benzoic acid |
| InChIKey | BHCHVMDIPYENNV-UHFFFAOYSA-N |
| SMILES | C1CNS(=O)(=O)N(C1)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)