CAS 2287282-65-7 is the registry number for 9-Methyl-2,9-dihydro-1H-purin-2-one dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
9-methyl-3H-purin-2-one;dihydrochloride (CAS 2287282-65-7) is a chemical compound with the molecular formula C6H8Cl2N4O and a molecular weight of 223.06 g/mol. IUPAC name: 9-methyl-3H-purin-2-one;dihydrochloride. InChIKey: SGWPRJVQRQWMCL-UHFFFAOYSA-N.
| Molecular formula | C6H8Cl2N4O |
|---|---|
| Molecular weight | 223.06 g/mol |
| IUPAC name | 9-methyl-3H-purin-2-one;dihydrochloride |
| InChIKey | SGWPRJVQRQWMCL-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1NC(=O)N=C2.Cl.Cl |
Computed by PubChem (NCBI)