CAS 2287287-54-9 is the registry number for tert-Butyl 4-(dimethyl-S-aminosulfonimidoyl)piperazine-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 4-(dimethylaminosulfonimidoyl)piperazine-1-carboxylate;hydrochloride (CAS 2287287-54-9) is a chemical compound with the molecular formula C11H25ClN4O3S and a molecular weight of 328.86 g/mol. IUPAC name: tert-butyl 4-(dimethylaminosulfonimidoyl)piperazine-1-carboxylate;hydrochloride. InChIKey: IQEAGMBXTNZZRZ-UHFFFAOYSA-N.
| Molecular formula | C11H25ClN4O3S |
|---|---|
| Molecular weight | 328.86 g/mol |
| IUPAC name | tert-butyl 4-(dimethylaminosulfonimidoyl)piperazine-1-carboxylate;hydrochloride |
| InChIKey | IQEAGMBXTNZZRZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)S(=N)(=O)N(C)C.Cl |
Computed by PubChem (NCBI)