Products 2287299-45-8

CAS 2287299-45-8 is the registry number for Ethyl 4-amino-2-fluoro-3-methylbutanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 4-amino-2-fluoro-3-methylbutanoate;hydrochloride (CAS 2287299-45-8) is a chemical compound with the molecular formula C7H15ClFNO2 and a molecular weight of 199.65 g/mol. IUPAC name: ethyl 4-amino-2-fluoro-3-methylbutanoate;hydrochloride. InChIKey: YUVGQUZRZPQLKL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H15ClFNO2
Molecular weight199.65 g/mol
IUPAC nameethyl 4-amino-2-fluoro-3-methylbutanoate;hydrochloride
InChIKeyYUVGQUZRZPQLKL-UHFFFAOYSA-N
SMILESCCOC(=O)C(C(C)CN)F.Cl

Computed by PubChem (NCBI)