CAS 2287311-66-2 is the registry number for [3,5-Bis(trifluoromethyl)phenyl]hydrazine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
[3,5-bis(trifluoromethyl)phenyl]hydrazine;dihydrochloride (CAS 2287311-66-2) is a chemical compound with the molecular formula C8H8Cl2F6N2 and a molecular weight of 317.06 g/mol. IUPAC name: [3,5-bis(trifluoromethyl)phenyl]hydrazine;dihydrochloride. InChIKey: PCJSMKGCRCAICK-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2F6N2 |
|---|---|
| Molecular weight | 317.06 g/mol |
| IUPAC name | [3,5-bis(trifluoromethyl)phenyl]hydrazine;dihydrochloride |
| InChIKey | PCJSMKGCRCAICK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)NN)C(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)