CAS 2287312-21-2 is the registry number for 4-(5-Amino-1H-benzo[d][1,2,3]triazol-1-yl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1-dioxothian-4-yl)benzotriazol-5-amine (CAS 2287312-21-2) is a chemical compound with the molecular formula C11H14N4O2S and a molecular weight of 266.32 g/mol. IUPAC name: 1-(1,1-dioxothian-4-yl)benzotriazol-5-amine. InChIKey: REIHGGXOHPYCKA-UHFFFAOYSA-N.
| Molecular formula | C11H14N4O2S |
|---|---|
| Molecular weight | 266.32 g/mol |
| IUPAC name | 1-(1,1-dioxothian-4-yl)benzotriazol-5-amine |
| InChIKey | REIHGGXOHPYCKA-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1N2C3=C(C=C(C=C3)N)N=N2 |
Computed by PubChem (NCBI)