CAS 2287316-28-1 is the registry number for 5-(Difluoromethyl)-1-methyl-1H-pyrazolo(4,3-b)pyridin-6-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(difluoromethyl)-1-methylpyrazolo[4,5-b]pyridin-6-amine;hydrochloride (CAS 2287316-28-1) is a chemical compound with the molecular formula C8H9ClF2N4 and a molecular weight of 234.63 g/mol. IUPAC name: 5-(difluoromethyl)-1-methylpyrazolo[4,5-b]pyridin-6-amine;hydrochloride. InChIKey: KPCNVULCFFHQND-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF2N4 |
|---|---|
| Molecular weight | 234.63 g/mol |
| IUPAC name | 5-(difluoromethyl)-1-methylpyrazolo[4,5-b]pyridin-6-amine;hydrochloride |
| InChIKey | KPCNVULCFFHQND-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)N=C(C(=C2)N)C(F)F.Cl |
Computed by PubChem (NCBI)