CAS 2287330-84-9 is the registry number for 2-(2-methylpyridin-4-yl)acetate lithium. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Lithium 2-(2-methyl-4-pyridinyl)acetate (CAS 2287330-84-9) is a chemical compound with the molecular formula C8H8LiNO2 and a molecular weight of 157.1 g/mol. IUPAC name: lithium 2-(2-methyl-4-pyridinyl)acetate. InChIKey: VOCCJWNQLGGIOL-UHFFFAOYSA-M.
| Molecular formula | C8H8LiNO2 |
|---|---|
| Molecular weight | 157.1 g/mol |
| IUPAC name | lithium 2-(2-methyl-4-pyridinyl)acetate |
| InChIKey | VOCCJWNQLGGIOL-UHFFFAOYSA-M |
| SMILES | [Li+].CC1=NC=CC(=C1)CC(=O)[O-] |
Computed by PubChem (NCBI)