CAS 2287330-87-2 is the registry number for 5-(Pentafluoroethoxy)pyridin-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(1,1,2,2,2-pentafluoroethoxy)pyridin-2-amine;hydrochloride (CAS 2287330-87-2) is a chemical compound with the molecular formula C7H6ClF5N2O and a molecular weight of 264.58 g/mol. IUPAC name: 5-(1,1,2,2,2-pentafluoroethoxy)pyridin-2-amine;hydrochloride. InChIKey: YKSPOBSVEXLLNG-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF5N2O |
|---|---|
| Molecular weight | 264.58 g/mol |
| IUPAC name | 5-(1,1,2,2,2-pentafluoroethoxy)pyridin-2-amine;hydrochloride |
| InChIKey | YKSPOBSVEXLLNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1OC(C(F)(F)F)(F)F)N.Cl |
Computed by PubChem (NCBI)