Products 2287331-12-6
CAS 2287331-12-6 is the registry number for 1,1-Bis(propan-2-yl) 3-tert-butylcyclobutane-1,1-dicarboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Dipropan-2-yl 3-tert-butylcyclobutane-1,1-dicarboxylate (CAS 2287331-12-6) is a chemical compound with the molecular formula C16H28O4 and a molecular weight of 284.39 g/mol. IUPAC name: dipropan-2-yl 3-tert-butylcyclobutane-1,1-dicarboxylate. InChIKey: TYOJDNIYJXPLTQ-UHFFFAOYSA-N.
| Molecular formula | C16H28O4 |
|---|---|
| Molecular weight | 284.39 g/mol |
| IUPAC name | dipropan-2-yl 3-tert-butylcyclobutane-1,1-dicarboxylate |
| InChIKey | TYOJDNIYJXPLTQ-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1(CC(C1)C(C)(C)C)C(=O)OC(C)C |
Computed by PubChem (NCBI)