Products 2287335-00-4

CAS 2287335-00-4 is the registry number for 1-Cyclobutyl-4,5-dihydro-1h-1,2,3,4-tetrazol-5-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

4-cyclobutyl-1H-tetrazol-5-one (CAS 2287335-00-4) is a chemical compound with the molecular formula C5H8N4O and a molecular weight of 140.14 g/mol. IUPAC name: 4-cyclobutyl-1H-tetrazol-5-one. InChIKey: NXRSGDVTQLWDHT-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8N4O
Molecular weight140.14 g/mol
IUPAC name4-cyclobutyl-1H-tetrazol-5-one
InChIKeyNXRSGDVTQLWDHT-UHFFFAOYSA-N
SMILESC1CC(C1)N2C(=O)NN=N2

Computed by PubChem (NCBI)