CAS 2287345-13-3 is the registry number for Dimethyl(1,2,3,4-tetrahydroquinolin-6-yl)phosphine oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-dimethylphosphoryl-1,2,3,4-tetrahydroquinoline (CAS 2287345-13-3) is a chemical compound with the molecular formula C11H16NOP and a molecular weight of 209.22 g/mol. IUPAC name: 6-dimethylphosphoryl-1,2,3,4-tetrahydroquinoline. InChIKey: OASQVPLTXCEXEB-UHFFFAOYSA-N.
| Molecular formula | C11H16NOP |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | 6-dimethylphosphoryl-1,2,3,4-tetrahydroquinoline |
| InChIKey | OASQVPLTXCEXEB-UHFFFAOYSA-N |
| SMILES | CP(=O)(C)C1=CC2=C(C=C1)NCCC2 |
Computed by PubChem (NCBI)