Products 2287346-64-7

CAS 2287346-64-7 is the registry number for (3S,4R)-3-methoxytetrahydropyran-4-amine hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

(3S,4R)-3-methoxyoxan-4-amine;hydrochloride (CAS 2287346-64-7) is a chemical compound with the molecular formula C6H14ClNO2 and a molecular weight of 167.63 g/mol. IUPAC name: (3S,4R)-3-methoxyoxan-4-amine;hydrochloride. InChIKey: DMWZYPXYPVHLOG-KGZKBUQUSA-N.

Identity
Molecular formulaC6H14ClNO2
Molecular weight167.63 g/mol
IUPAC name(3S,4R)-3-methoxyoxan-4-amine;hydrochloride
InChIKeyDMWZYPXYPVHLOG-KGZKBUQUSA-N
SMILESCO[C@@H]1COCC[C@H]1N.Cl

Computed by PubChem (NCBI)