CAS 22884-31-7 appears in our catalog under these names: Pentamethylenebis(triphenylphosphonium bromide), 95%, Pentamethylenebis(triphenylphosphonium bromide), Pentane-1,5-diylbis(triphenylphosphonium) bromide, 98%, 98%, Pentane-1,5-diylbis(triphenylphosphonium) bromide, 98%, Pentane-1,5-diylbis(triphenylphosphonium) bromide, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100g.
Triphenyl(5-triphenylphosphaniumylpentyl)phosphanium dibromide (CAS 22884-31-7) is a chemical compound with the molecular formula C41H40Br2P2 and a molecular weight of 754.5 g/mol. IUPAC name: triphenyl(5-triphenylphosphaniumylpentyl)phosphanium dibromide. InChIKey: XIZMFZWZYVQIOX-UHFFFAOYSA-L.
| Molecular formula | C41H40Br2P2 |
|---|---|
| Molecular weight | 754.5 g/mol |
| IUPAC name | triphenyl(5-triphenylphosphaniumylpentyl)phosphanium dibromide |
| InChIKey | XIZMFZWZYVQIOX-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)[P+](CCCCC[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6.[Br-].[Br-] |
Computed by PubChem (NCBI)